Difference between revisions of "N-Substituted-Aminoacyl-tRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-316 == * common-name: ** reduced riboflavin * smiles: ** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-19339 == * common-name: ** α-d-sedoheptulopyranose 7-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1) * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-19339 == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-d-sedoheptulopyranose 7-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cbidvwsruuodhl-ovhbtucosa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 288.147 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9140]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-d-sedoheptulopyranose 7-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cbidvwsruuodhl-ovhbtucosa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=288.147}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-19339
- common-name:
- α-d-sedoheptulopyranose 7-phosphate
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1)
- inchi-key:
- cbidvwsruuodhl-ovhbtucosa-l
- molecular-weight:
- 288.147
