Difference between revisions of "CPD-8343"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYOX == * common-name: ** glyoxylate * smiles: ** [ch](c(=o)[o-])=o * inchi-key: ** hhlfwlyxyjoton-uhfffaoysa-m * molecular-weight: ** 7...") |
(Created page with "Category:metabolite == Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE == * common-name: ** n7-methylguanosine 5'-phosphate * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** n7-methylguanosine 5'-phosphate |
* smiles: | * smiles: | ||
− | ** [ | + | ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])[o-])c(o)c(o)3)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** aokqnzvjjxpuqa-kqynxxcusa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 376.242 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-12826]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12826]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n7-methylguanosine 5'-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=aokqnzvjjxpuqa-kqynxxcusa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=376.242}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE
- common-name:
- n7-methylguanosine 5'-phosphate
- smiles:
- c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])[o-])c(o)c(o)3))
- inchi-key:
- aokqnzvjjxpuqa-kqynxxcusa-m
- molecular-weight:
- 376.242