Difference between revisions of "CPD1G-332"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CDP-2-3-4-Saturated-Diacylglycerols == * common-name: ** a cdp-2,3,4-saturated-diacylglycerol == Reaction(s) known to consume the compoun...")
(Created page with "Category:metabolite == Metabolite CPD-9038 == * common-name: ** precorrin-1 * smiles: ** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CDP-2-3-4-Saturated-Diacylglycerols ==
+
== Metabolite CPD-9038 ==
 
* common-name:
 
* common-name:
** a cdp-2,3,4-saturated-diacylglycerol
+
** precorrin-1
 +
* smiles:
 +
** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o)
 +
* inchi-key:
 +
** cjlvuwulfkhgfb-nzcajupmsa-f
 +
* molecular-weight:
 +
** 842.768
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8675]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5515]]
+
* [[UROPORIIIMETHYLTRANSA-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cdp-2,3,4-saturated-diacylglycerol}}
+
{{#set: common-name=precorrin-1}}
 +
{{#set: inchi-key=inchikey=cjlvuwulfkhgfb-nzcajupmsa-f}}
 +
{{#set: molecular-weight=842.768}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-9038

  • common-name:
    • precorrin-1
  • smiles:
    • cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o)
  • inchi-key:
    • cjlvuwulfkhgfb-nzcajupmsa-f
  • molecular-weight:
    • 842.768

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality