Difference between revisions of "CPD-14423"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Sulfhydryls == * common-name: ** r'c(r)sh == Reaction(s) known to consume the compound == * THIOL-OXIDASE-RXN == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * smiles: ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) * inchi-key: ** whomfkwh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PYRIDOXINE-5P == |
* common-name: | * common-name: | ||
| − | ** | + | ** pyridoxine 5'-phosphate |
| + | * smiles: | ||
| + | ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) | ||
| + | * inchi-key: | ||
| + | ** whomfkwhiqzthy-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 247.144 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PNPOXI-RXN]] |
| + | * [[RXN-14181]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PNKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pyridoxine 5'-phosphate}} |
| + | {{#set: inchi-key=inchikey=whomfkwhiqzthy-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=247.144}} | ||
Revision as of 13:12, 14 January 2021
Contents
Metabolite PYRIDOXINE-5P
- common-name:
- pyridoxine 5'-phosphate
- smiles:
- cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co)
- inchi-key:
- whomfkwhiqzthy-uhfffaoysa-l
- molecular-weight:
- 247.144
