Difference between revisions of "CPD-419"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15661 == * common-name: ** 2-trans, 4-trans-undecadienoyl-coa * smiles: ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
(Created page with "Category:metabolite == Metabolite CPD-13613 == * common-name: ** l-threo-sphinganine * smiles: ** cccccccccccccccc(c(co)[n+])o * inchi-key: ** otkjdmgtuttymp-rouuacijsa-o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15661 ==
+
== Metabolite CPD-13613 ==
 
* common-name:
 
* common-name:
** 2-trans, 4-trans-undecadienoyl-coa
+
** l-threo-sphinganine
 
* smiles:
 
* smiles:
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccccccccccccc(c(co)[n+])o
 
* inchi-key:
 
* inchi-key:
** szkpluulggerfd-msnzeopqsa-j
+
** otkjdmgtuttymp-rouuacijsa-o
 
* molecular-weight:
 
* molecular-weight:
** 927.749
+
** 302.519
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14790]]
+
* [[RXN-12645]]
* [[RXN-14791]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14789]]
+
* [[RXN-12645]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans, 4-trans-undecadienoyl-coa}}
+
{{#set: common-name=l-threo-sphinganine}}
{{#set: inchi-key=inchikey=szkpluulggerfd-msnzeopqsa-j}}
+
{{#set: inchi-key=inchikey=otkjdmgtuttymp-rouuacijsa-o}}
{{#set: molecular-weight=927.749}}
+
{{#set: molecular-weight=302.519}}

Revision as of 13:12, 14 January 2021

Metabolite CPD-13613

  • common-name:
    • l-threo-sphinganine
  • smiles:
    • cccccccccccccccc(c(co)[n+])o
  • inchi-key:
    • otkjdmgtuttymp-rouuacijsa-o
  • molecular-weight:
    • 302.519

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality