Difference between revisions of "PRISTANATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DELTA-TOCOPHEROL == * common-name: ** δ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) * inchi-key: ** loyxtwzxlwh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-6993 == |
* common-name: | * common-name: | ||
| − | ** | + | ** pinocembrin chalcone |
* smiles: | * smiles: | ||
| − | ** cc(c | + | ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** loyxtwzxlwhmbx-votsokgwsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 256.257 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7647]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7645]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pinocembrin chalcone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.257}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-6993
- common-name:
- pinocembrin chalcone
- smiles:
- c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
- inchi-key:
- loyxtwzxlwhmbx-votsokgwsa-n
- molecular-weight:
- 256.257
