Difference between revisions of "CPD-17312"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Crotonyl-ACPs == * common-name: ** a crotonyl-[acp] == Reaction(s) known to consume the compound == * RXN-9515 * RXN-9657 == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-8092 == * common-name: ** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8092 == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine |
+ | * smiles: | ||
+ | ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o | ||
+ | * inchi-key: | ||
+ | ** fvqgnfubhwgfcy-hjoyqdmmsa-n | ||
+ | * molecular-weight: | ||
+ | ** 782.092 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-8324]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-8326]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-oleoyl-2-α-linolenoyl-phosphatidylcholine}} |
+ | {{#set: inchi-key=inchikey=fvqgnfubhwgfcy-hjoyqdmmsa-n}} | ||
+ | {{#set: molecular-weight=782.092}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-8092
- common-name:
- 1-oleoyl-2-α-linolenoyl-phosphatidylcholine
- smiles:
- ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- fvqgnfubhwgfcy-hjoyqdmmsa-n
- molecular-weight:
- 782.092