Difference between revisions of "ADENOSYLCOBALAMIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MAPKK-L-serine-or-L-threonine == * common-name: ** a [map kinase kinase]-(l-serine/l-threonine) == Reaction(s) known to consume the compo...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE == * common-name: ** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** czfrmaseeptbaq-mycgwmctsa-n | ||
| + | * molecular-weight: | ||
| + | ** 685.084 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[2 | + | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol}} |
| + | {{#set: inchi-key=inchikey=czfrmaseeptbaq-mycgwmctsa-n}} | ||
| + | {{#set: molecular-weight=685.084}} | ||
Revision as of 13:13, 14 January 2021
Contents
Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE
- common-name:
- 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c
- inchi-key:
- czfrmaseeptbaq-mycgwmctsa-n
- molecular-weight:
- 685.084
