Difference between revisions of "Ferrihemoglobins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Palmitoyl-ACPs == * common-name: ** a palmitoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16025 * RXN-17018 * [...")
(Created page with "Category:metabolite == Metabolite UDP-D-XYLOSE == * common-name: ** udp-α-d-xylose * smiles: ** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Palmitoyl-ACPs ==
+
== Metabolite UDP-D-XYLOSE ==
 
* common-name:
 
* common-name:
** a palmitoyl-[acp]
+
** udp-α-d-xylose
 +
* smiles:
 +
** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
 +
* inchi-key:
 +
** dqqdlyvhotzlor-ocimbmbzsa-l
 +
* molecular-weight:
 +
** 534.263
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16025]]
+
* [[2.4.2.26-RXN]]
* [[RXN-17018]]
+
* [[2.4.2.38-RXN]]
* [[RXN-9549]]
+
* [[2.7.7.11-RXN]]
* [[RXN-9632]]
+
* [[RXN-9104]]
* [[RXN0-6705]]
+
* [[UA4E]]
* [[RXN3O-1803]]
 
* [[RXN3O-9780]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9542]]
+
* [[2.7.7.11-RXN]]
* [[RXN-9663]]
+
* [[UA4E]]
 +
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 +
* [[UGDC]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a palmitoyl-[acp]}}
+
{{#set: common-name=udp-α-d-xylose}}
 +
{{#set: inchi-key=inchikey=dqqdlyvhotzlor-ocimbmbzsa-l}}
 +
{{#set: molecular-weight=534.263}}

Revision as of 13:13, 14 January 2021

Metabolite UDP-D-XYLOSE

  • common-name:
    • udp-α-d-xylose
  • smiles:
    • c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
  • inchi-key:
    • dqqdlyvhotzlor-ocimbmbzsa-l
  • molecular-weight:
    • 534.263

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality