Difference between revisions of "CPD-10809"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XANTHOSINE-5-PHOSPHATE == * common-name: ** xmp * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-12677 == * common-name: ** 5-chloro-5-deoxyribose 1-phosphate * smiles: ** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1) * inchi-key: ** dgv...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-12677 == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-chloro-5-deoxyribose 1-phosphate |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** dgviesznpvjdpq-soofdhnksa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 246.541 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11715]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-chloro-5-deoxyribose 1-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dgviesznpvjdpq-soofdhnksa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=246.541}} |
Revision as of 13:13, 14 January 2021
Contents
Metabolite CPD-12677
- common-name:
- 5-chloro-5-deoxyribose 1-phosphate
- smiles:
- c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
- inchi-key:
- dgviesznpvjdpq-soofdhnksa-l
- molecular-weight:
- 246.541