Difference between revisions of "CPD-4702"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19160 == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * smiles: ** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * common-name: ** (s)-2-acetolactate * smiles: ** cc(=o)c(c)(o)c(=o)[o-] * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19160 ==
+
== Metabolite 2-ACETO-LACTATE ==
 
* common-name:
 
* common-name:
** 3-oxo-(11z)-octadecenoyl-coa
+
** (s)-2-acetolactate
 
* smiles:
 
* smiles:
** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(=o)c(c)(o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** ourowzutgfhrje-saiinbspsa-j
+
** nmdwgegfjubklb-yfkpbyrvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 131.108
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17787]]
+
* [[ACETOLACTREDUCTOISOM-RXN]]
 +
* [[RXN-14037]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17786]]
+
* [[ACETOLACTSYN-RXN]]
 +
* [[RXN-14037]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}}
+
{{#set: common-name=(s)-2-acetolactate}}
{{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}}
+
{{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=131.108}}

Revision as of 13:13, 14 January 2021

Metabolite 2-ACETO-LACTATE

  • common-name:
    • (s)-2-acetolactate
  • smiles:
    • cc(=o)c(c)(o)c(=o)[o-]
  • inchi-key:
    • nmdwgegfjubklb-yfkpbyrvsa-m
  • molecular-weight:
    • 131.108

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality