Difference between revisions of "CPD-341"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Demethylated-Ubiquinols == * common-name: ** a demethylated ubiquinol == Reaction(s) known to consume the compound == * RXN-11758 ==...") |
(Created page with "Category:metabolite == Metabolite INDOLE_PYRUVATE == * common-name: ** (indol-3-yl)pyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** rstklpzezyg...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite INDOLE_PYRUVATE == |
* common-name: | * common-name: | ||
− | ** | + | ** (indol-3-yl)pyruvate |
+ | * smiles: | ||
+ | ** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2)) | ||
+ | * inchi-key: | ||
+ | ** rstklpzezygqpy-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 202.189 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[RXNDQC-2]] |
+ | * [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(indol-3-yl)pyruvate}} |
+ | {{#set: inchi-key=inchikey=rstklpzezygqpy-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=202.189}} |
Revision as of 18:52, 14 January 2021
Contents
Metabolite INDOLE_PYRUVATE
- common-name:
- (indol-3-yl)pyruvate
- smiles:
- c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- rstklpzezygqpy-uhfffaoysa-m
- molecular-weight:
- 202.189