Difference between revisions of "CPD-341"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Demethylated-Ubiquinols == * common-name: ** a demethylated ubiquinol == Reaction(s) known to consume the compound == * RXN-11758 ==...")
(Created page with "Category:metabolite == Metabolite INDOLE_PYRUVATE == * common-name: ** (indol-3-yl)pyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** rstklpzezyg...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Demethylated-Ubiquinols ==
+
== Metabolite INDOLE_PYRUVATE ==
 
* common-name:
 
* common-name:
** a demethylated ubiquinol
+
** (indol-3-yl)pyruvate
 +
* smiles:
 +
** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2))
 +
* inchi-key:
 +
** rstklpzezygqpy-uhfffaoysa-m
 +
* molecular-weight:
 +
** 202.189
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11758]]
+
* [[RXNDQC-2]]
 +
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a demethylated ubiquinol}}
+
{{#set: common-name=(indol-3-yl)pyruvate}}
 +
{{#set: inchi-key=inchikey=rstklpzezygqpy-uhfffaoysa-m}}
 +
{{#set: molecular-weight=202.189}}

Revision as of 18:52, 14 January 2021

Metabolite INDOLE_PYRUVATE

  • common-name:
    • (indol-3-yl)pyruvate
  • smiles:
    • c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2))
  • inchi-key:
    • rstklpzezygqpy-uhfffaoysa-m
  • molecular-weight:
    • 202.189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality