Difference between revisions of "CPD-17351"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uracil-1939 == * common-name: ** a uracil1939 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11601 == Rea...")
(Created page with "Category:metabolite == Metabolite CPD-2182 == * common-name: ** 1-linoleoyl-2-linoleoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 23S-rRNA-uracil-1939 ==
+
== Metabolite CPD-2182 ==
 
* common-name:
 
* common-name:
** a uracil1939 in 23s rrna
+
** 1-linoleoyl-2-linoleoyl-phosphatidylcholine
 +
* smiles:
 +
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 +
* inchi-key:
 +
** fvxdqwzbhixiej-lndkuqbdsa-n
 +
* molecular-weight:
 +
** 782.092
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11601]]
+
* [[RXN-8323]]
 +
* [[RXN-8329]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8322]]
 +
* [[RXN-8328]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a uracil1939 in 23s rrna}}
+
{{#set: common-name=1-linoleoyl-2-linoleoyl-phosphatidylcholine}}
 +
{{#set: inchi-key=inchikey=fvxdqwzbhixiej-lndkuqbdsa-n}}
 +
{{#set: molecular-weight=782.092}}

Revision as of 18:52, 14 January 2021

Metabolite CPD-2182

  • common-name:
    • 1-linoleoyl-2-linoleoyl-phosphatidylcholine
  • smiles:
    • cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • fvxdqwzbhixiej-lndkuqbdsa-n
  • molecular-weight:
    • 782.092

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality