Difference between revisions of "QUEUINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == * common-name: ** icosapentaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** jazb...")
(Created page with "Category:metabolite == Metabolite CPD-13670 == * common-name: ** 30-hydroxy-11-oxo-β-amyrin * smiles: ** cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE ==
+
== Metabolite CPD-13670 ==
 
* common-name:
 
* common-name:
** icosapentaenoate
+
** 30-hydroxy-11-oxo-β-amyrin
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]
+
** cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c))c)c))c)o)c
 
* inchi-key:
 
* inchi-key:
** jazbehyotptenj-jlnkqsitsa-m
+
** jcgxiyqlryphdg-zbyjljtqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 301.448
+
** 456.707
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12978]]
+
* [[RXN-13493]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13430]]
+
* [[RXN-13492]]
* [[RXN-13431]]
 
* [[RXN-16139]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=icosapentaenoate}}
+
{{#set: common-name=30-hydroxy-11-oxo-β-amyrin}}
{{#set: inchi-key=inchikey=jazbehyotptenj-jlnkqsitsa-m}}
+
{{#set: inchi-key=inchikey=jcgxiyqlryphdg-zbyjljtqsa-n}}
{{#set: molecular-weight=301.448}}
+
{{#set: molecular-weight=456.707}}

Revision as of 18:52, 14 January 2021

Metabolite CPD-13670

  • common-name:
    • 30-hydroxy-11-oxo-β-amyrin
  • smiles:
    • cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c))c)c))c)o)c
  • inchi-key:
    • jcgxiyqlryphdg-zbyjljtqsa-n
  • molecular-weight:
    • 456.707

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality