Difference between revisions of "Cyclic-Phosphate-Terminated-RNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12906 == * common-name: ** 5-methyl-3-oxo-4-hexenoyl-coa * smiles: ** cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(oc...")
(Created page with "Category:metabolite == Metabolite XLFG-Xyloglucans == * common-name: ** an xlfg xylogulcan == Reaction(s) known to consume the compound == == Reaction(s) known to produce...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12906 ==
+
== Metabolite XLFG-Xyloglucans ==
 
* common-name:
 
* common-name:
** 5-methyl-3-oxo-4-hexenoyl-coa
+
** an xlfg xylogulcan
* smiles:
 
** cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** zfkzvsujtdsjey-svhodsnwsa-j
 
* molecular-weight:
 
** 887.641
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11921]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9463]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methyl-3-oxo-4-hexenoyl-coa}}
+
{{#set: common-name=an xlfg xylogulcan}}
{{#set: inchi-key=inchikey=zfkzvsujtdsjey-svhodsnwsa-j}}
 
{{#set: molecular-weight=887.641}}
 

Revision as of 18:52, 14 January 2021

Metabolite XLFG-Xyloglucans

  • common-name:
    • an xlfg xylogulcan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality