Difference between revisions of "3-INDOLYLGLYCOLALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P == * common-name: ** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine * smiles: ** cc1(n=cc(cop(=o)([o-])...")
(Created page with "Category:metabolite == Metabolite Cleaved-Angiotensinogen == * common-name: ** a cleaved angiotensinogen == Reaction(s) known to consume the compound == == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P ==
+
== Metabolite Cleaved-Angiotensinogen ==
 
* common-name:
 
* common-name:
** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
+
** a cleaved angiotensinogen
* smiles:
 
** cc1(n=cc(cop(=o)([o-])[o-])=c(n=1)n)
 
* inchi-key:
 
** pkyfhkiyhbrtpi-uhfffaoysa-l
 
* molecular-weight:
 
** 217.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PYRIMSYN3-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[OHMETPYRKIN-RXN]]
+
* [[3.4.23.15-RXN]]
* [[PYRIMSYN1-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine}}
+
{{#set: common-name=a cleaved angiotensinogen}}
{{#set: inchi-key=inchikey=pkyfhkiyhbrtpi-uhfffaoysa-l}}
 
{{#set: molecular-weight=217.121}}
 

Revision as of 18:53, 14 January 2021

Metabolite Cleaved-Angiotensinogen

  • common-name:
    • a cleaved angiotensinogen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality