Difference between revisions of "CPD-7100"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOHEXAOSE == * common-name: ** maltohexaose * smiles: ** c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)...")
(Created page with "Category:metabolite == Metabolite CPD-12365 == * common-name: ** 8-oxo-dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** aq...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOHEXAOSE ==
+
== Metabolite CPD-12365 ==
 
* common-name:
 
* common-name:
** maltohexaose
+
** 8-oxo-dgmp
 
* smiles:
 
* smiles:
** c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c5o)o)co))c(c(c6o)o)o))o
+
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
* inchi-key:
** ocibbxpluvykch-liggpisvsa-n
+
** aqivlflyhyfrku-vpeninkcsa-l
 
* molecular-weight:
 
* molecular-weight:
** 990.867
+
** 361.207
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14282]]
+
* [[RXN-14205]]
* [[RXN-14285]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14283]]
+
* [[RXN-11396]]
* [[RXN-14286]]
+
* [[RXN-12816]]
* [[RXN0-5181]]
+
* [[RXN-14205]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltohexaose}}
+
{{#set: common-name=8-oxo-dgmp}}
{{#set: inchi-key=inchikey=ocibbxpluvykch-liggpisvsa-n}}
+
{{#set: inchi-key=inchikey=aqivlflyhyfrku-vpeninkcsa-l}}
{{#set: molecular-weight=990.867}}
+
{{#set: molecular-weight=361.207}}

Revision as of 18:53, 14 January 2021

Metabolite CPD-12365

  • common-name:
    • 8-oxo-dgmp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • aqivlflyhyfrku-vpeninkcsa-l
  • molecular-weight:
    • 361.207

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality