Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9460 == * common-name: ** oleanolate 3 β-d-glucuronoside * smiles: ** cc6(ccc5(ccc1(c(=cc[ch]2(c1(cc[ch]3(c2(ccc(c3(c)c)oc4(c(c(...")
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL == * common-name: ** 2-methoxy-6-(all-trans-octaprenyl)phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9460 ==
+
== Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL ==
 
* common-name:
 
* common-name:
** oleanolate 3 β-d-glucuronoside
+
** 2-methoxy-6-(all-trans-octaprenyl)phenol
 
* smiles:
 
* smiles:
** cc6(ccc5(ccc1(c(=cc[ch]2(c1(cc[ch]3(c2(ccc(c3(c)c)oc4(c(c(c(c(o4)c(=o)[o-])o)o)o))c))c))[ch]5c6)c)c(=o)[o-])c
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** iuchkmazawjnbj-rcyxvvtdsa-l
+
** margkpimnmaskj-cmaxttdksa-n
 
* molecular-weight:
 
* molecular-weight:
** 630.817
+
** 669.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9000]]
+
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oleanolate 3 β-d-glucuronoside}}
+
{{#set: common-name=2-methoxy-6-(all-trans-octaprenyl)phenol}}
{{#set: inchi-key=inchikey=iuchkmazawjnbj-rcyxvvtdsa-l}}
+
{{#set: inchi-key=inchikey=margkpimnmaskj-cmaxttdksa-n}}
{{#set: molecular-weight=630.817}}
+
{{#set: molecular-weight=669.085}}

Revision as of 18:53, 14 January 2021

Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL

  • common-name:
    • 2-methoxy-6-(all-trans-octaprenyl)phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c
  • inchi-key:
    • margkpimnmaskj-cmaxttdksa-n
  • molecular-weight:
    • 669.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality