Difference between revisions of "CATECHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Oxidized-flavodoxins == * common-name: ** an oxidized flavodoxin == Reaction(s) known to consume the compound == * [[FLAVONADPREDUCT-RXN]...") |
(Created page with "Category:metabolite == Metabolite CPD-17375 == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol * smiles: ** c(o)cccccccc=ccccccccc(occ(oc(=o)cccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17375 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol |
| + | * smiles: | ||
| + | ** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)co)=o | ||
| + | * inchi-key: | ||
| + | ** rcalbbvhqnuwno-osfdyrcisa-n | ||
| + | * molecular-weight: | ||
| + | ** 650.978 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-16121]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol}} |
| + | {{#set: inchi-key=inchikey=rcalbbvhqnuwno-osfdyrcisa-n}} | ||
| + | {{#set: molecular-weight=650.978}} | ||
Revision as of 18:53, 14 January 2021
Contents
Metabolite CPD-17375
- common-name:
- 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol
- smiles:
- c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)co)=o
- inchi-key:
- rcalbbvhqnuwno-osfdyrcisa-n
- molecular-weight:
- 650.978
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
