Difference between revisions of "CPD-17375"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P == * common-name: ** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole...")
(Created page with "Category:metabolite == Metabolite 5-methylcytosine2278-in-25S-rRNA == * common-name: ** a 5-methylcytosine2278 in 25s rrna == Reaction(s) known to consume the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P ==
+
== Metabolite 5-methylcytosine2278-in-25S-rRNA ==
 
* common-name:
 
* common-name:
** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide
+
** a 5-methylcytosine2278 in 25s rrna
* smiles:
 
** c(nc1(oc(cop([o-])(=o)[o-])c(o)c(o)1))=nc3(=c(c(n)=o)n=cn(c2(oc(cop([o-])(=o)[o-])c(o)c(o)2))3)
 
* inchi-key:
 
** qoushgmtbiiahr-keohhstqsa-j
 
* molecular-weight:
 
** 573.303
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PRIBFAICARPISOM-RXN]]
 
* [[PRICI]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTCYCLOHYD-RXN]]
+
* [[RXN-15844]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide}}
+
{{#set: common-name=a 5-methylcytosine2278 in 25s rrna}}
{{#set: inchi-key=inchikey=qoushgmtbiiahr-keohhstqsa-j}}
 
{{#set: molecular-weight=573.303}}
 

Revision as of 18:53, 14 January 2021

Metabolite 5-methylcytosine2278-in-25S-rRNA

  • common-name:
    • a 5-methylcytosine2278 in 25s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality