Difference between revisions of "PHYTOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-octaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite GLYCYLGLYCINE == * common-name: ** glycyl-glycine * smiles: ** c([n+])c(=o)ncc([o-])=o * inchi-key: ** ymawopbaydpsla-uhfffaoysa-n * mole...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTAPRENYL-DIPHOSPHATE ==
+
== Metabolite GLYCYLGLYCINE ==
 
* common-name:
 
* common-name:
** all-trans-octaprenyl diphosphate
+
** glycyl-glycine
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+
** c([n+])c(=o)ncc([o-])=o
 
* inchi-key:
 
* inchi-key:
** ikkldissulffqo-djmiluhssa-k
+
** ymawopbaydpsla-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 719.897
+
** 132.119
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
+
* [[RXN-18092]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-octaprenyl diphosphate}}
+
{{#set: common-name=glycyl-glycine}}
{{#set: inchi-key=inchikey=ikkldissulffqo-djmiluhssa-k}}
+
{{#set: inchi-key=inchikey=ymawopbaydpsla-uhfffaoysa-n}}
{{#set: molecular-weight=719.897}}
+
{{#set: molecular-weight=132.119}}

Revision as of 18:53, 14 January 2021

Metabolite GLYCYLGLYCINE

  • common-name:
    • glycyl-glycine
  • smiles:
    • c([n+])c(=o)ncc([o-])=o
  • inchi-key:
    • ymawopbaydpsla-uhfffaoysa-n
  • molecular-weight:
    • 132.119

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality