Difference between revisions of "CPD-12118"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SCOPOLIN == * common-name: ** scopolin * smiles: ** coc2(=cc1(=c(oc(c=c1)=o)c=c2oc3(c(c(c(o)c(co)o3)o)o))) * inchi-key: ** sgtcgccqzoumjj...")
(Created page with "Category:metabolite == Metabolite Carboxylic-esters == * common-name: ** a carboxylic ester == Reaction(s) known to consume the compound == * CARBOXYLESTERASE-RXN == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SCOPOLIN ==
+
== Metabolite Carboxylic-esters ==
 
* common-name:
 
* common-name:
** scopolin
+
** a carboxylic ester
* smiles:
 
** coc2(=cc1(=c(oc(c=c1)=o)c=c2oc3(c(c(c(o)c(co)o3)o)o)))
 
* inchi-key:
 
** sgtcgccqzoumjj-ymiltqatsa-n
 
* molecular-weight:
 
** 354.313
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14179]]
+
* [[CARBOXYLESTERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=scopolin}}
+
{{#set: common-name=a carboxylic ester}}
{{#set: inchi-key=inchikey=sgtcgccqzoumjj-ymiltqatsa-n}}
 
{{#set: molecular-weight=354.313}}
 

Revision as of 18:53, 14 January 2021

Metabolite Carboxylic-esters

  • common-name:
    • a carboxylic ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality