Difference between revisions of "PORPHOBILINOGEN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7003 == * common-name: ** tetrahydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)...")
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL == * common-name: ** an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosam...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7003 ==
+
== Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL ==
 
* common-name:
 
* common-name:
** tetrahydrogeranylgeranyl diphosphate
+
** an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r
* smiles:
 
** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
 
* inchi-key:
 
** vzbgwadxujsbti-pyddkjgssa-k
 
* molecular-weight:
 
** 451.456
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7659]]
 
* [[RXN-7660]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7659]]
+
* [[2.4.1.151-RXN]]
* [[RXN-7660]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetrahydrogeranylgeranyl diphosphate}}
+
{{#set: common-name=an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r}}
{{#set: inchi-key=inchikey=vzbgwadxujsbti-pyddkjgssa-k}}
 
{{#set: molecular-weight=451.456}}
 

Revision as of 18:53, 14 January 2021

Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL

  • common-name:
    • an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality