Difference between revisions of "Delta5-Delta7-Steroids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIVINYLCHLOROPHYLLIDE-A == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[...") |
(Created page with "Category:metabolite == Metabolite CPD-13395 == * common-name: ** glycyl-l-asparagine * smiles: ** c([n+])c(=o)nc(cc(n)=o)c([o-])=o * inchi-key: ** fuesbomyallfni-vkhmyheas...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13395 == |
| + | * common-name: | ||
| + | ** glycyl-l-asparagine | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c([n+])c(=o)nc(cc(n)=o)c([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** fuesbomyallfni-vkhmyheasa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 189.171 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6982]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyl-l-asparagine}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=fuesbomyallfni-vkhmyheasa-n}} |
| + | {{#set: molecular-weight=189.171}} | ||
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-13395
- common-name:
- glycyl-l-asparagine
- smiles:
- c([n+])c(=o)nc(cc(n)=o)c([o-])=o
- inchi-key:
- fuesbomyallfni-vkhmyheasa-n
- molecular-weight:
- 189.171
