Difference between revisions of "A-5-prime-PP-5-prime-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11665 == * common-name: ** serotonin o-sulfate * smiles: ** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2)) * inchi-key: ** jfwysggscoobgk-uh...") |
(Created page with "Category:metabolite == Metabolite Polyamines == * common-name: ** a polyamine == Reaction(s) known to consume the compound == * 3.6.3.31-RXN == Reaction(s) known to pr...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Polyamines == |
* common-name: | * common-name: | ||
− | ** | + | ** a polyamine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3.6.3.31-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[3.6.3.31-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a polyamine}} |
− | |||
− |
Revision as of 18:54, 14 January 2021
Contents
Metabolite Polyamines
- common-name:
- a polyamine