Difference between revisions of "CPD-7880"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5662 == * common-name: ** 9-mercaptodethiobiotin * smiles: ** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-]) * inchi-key: ** zarfdbykhcotrh-uhfffa...") |
(Created page with "Category:metabolite == Metabolite DEOXY-RIBOSE-5P == * common-name: ** 2-deoxy-d-ribose 5-phosphate == Reaction(s) known to consume the compound == * D-PPENTOMUT-RXN =...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DEOXY-RIBOSE-5P == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-deoxy-d-ribose 5-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[D-PPENTOMUT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[D-PPENTOMUT-RXN]] |
+ | * [[RXN-14223]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-deoxy-d-ribose 5-phosphate}} |
− | |||
− |
Revision as of 18:54, 14 January 2021
Contents
Metabolite DEOXY-RIBOSE-5P
- common-name:
- 2-deoxy-d-ribose 5-phosphate