Difference between revisions of "CPD-7880"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5662 == * common-name: ** 9-mercaptodethiobiotin * smiles: ** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-]) * inchi-key: ** zarfdbykhcotrh-uhfffa...")
(Created page with "Category:metabolite == Metabolite DEOXY-RIBOSE-5P == * common-name: ** 2-deoxy-d-ribose 5-phosphate == Reaction(s) known to consume the compound == * D-PPENTOMUT-RXN =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-5662 ==
+
== Metabolite DEOXY-RIBOSE-5P ==
 
* common-name:
 
* common-name:
** 9-mercaptodethiobiotin
+
** 2-deoxy-d-ribose 5-phosphate
* smiles:
 
** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-])
 
* inchi-key:
 
** zarfdbykhcotrh-uhfffaoysa-m
 
* molecular-weight:
 
** 245.316
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17473]]
+
* [[D-PPENTOMUT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17472]]
+
* [[D-PPENTOMUT-RXN]]
 +
* [[RXN-14223]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=9-mercaptodethiobiotin}}
+
{{#set: common-name=2-deoxy-d-ribose 5-phosphate}}
{{#set: inchi-key=inchikey=zarfdbykhcotrh-uhfffaoysa-m}}
 
{{#set: molecular-weight=245.316}}
 

Revision as of 18:54, 14 January 2021

Metabolite DEOXY-RIBOSE-5P

  • common-name:
    • 2-deoxy-d-ribose 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality