Difference between revisions of "CPD-15172"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4617 == * common-name: ** dihydrozeatin-o-glucoside * smiles: ** cc(ccnc1(c2(=c(n=cn=1)nc=n2)))coc3(c(c(c(c(o3)co)o)o)o) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-4143 == * common-name: ** sitosterol * smiles: ** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-key...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-4143 == |
* common-name: | * common-name: | ||
| − | ** | + | ** sitosterol |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kzjwdpnrjallns-vjsfxxlfsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 414.713 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12128]] | ||
| + | * [[RXN-12789]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12789]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sitosterol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kzjwdpnrjallns-vjsfxxlfsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=414.713}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-4143
- common-name:
- sitosterol
- smiles:
- ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- kzjwdpnrjallns-vjsfxxlfsa-n
- molecular-weight:
- 414.713
