Difference between revisions of "CPD-17387"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4143 == * common-name: ** sitosterol * smiles: ** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite CPD-4203 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-4203 == |
* common-name: | * common-name: | ||
− | ** | + | ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vxmxkdahjurhen-sdbhatresa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 492.298 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-4311]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-4305]] |
+ | * [[RXN-4311]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-diphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vxmxkdahjurhen-sdbhatresa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=492.298}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-4203
- common-name:
- n6-(δ2-isopentenyl)-adenosine 5'-diphosphate
- smiles:
- cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c
- inchi-key:
- vxmxkdahjurhen-sdbhatresa-k
- molecular-weight:
- 492.298