Difference between revisions of "Oxidized-hemoproteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Negatively-super-coiled-DNAs == * common-name: ** a negatively supercoiled dna == Reaction(s) known to consume the compound == * 5.99.1...")
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P == * common-name: ** 7,8-dihydroneopterin 3'-phosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Negatively-super-coiled-DNAs ==
+
== Metabolite DIHYDRONEOPTERIN-P ==
 
* common-name:
 
* common-name:
** a negatively supercoiled dna
+
** 7,8-dihydroneopterin 3'-phosphate
 +
* smiles:
 +
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
 +
* inchi-key:
 +
** plsqmgzyogsoce-xinawcovsa-l
 +
* molecular-weight:
 +
** 333.197
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[5.99.1.2-RXN]]
+
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
* [[5.99.1.3-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[5.99.1.2-RXN]]
+
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
* [[5.99.1.3-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a negatively supercoiled dna}}
+
{{#set: common-name=7,8-dihydroneopterin 3'-phosphate}}
 +
{{#set: inchi-key=inchikey=plsqmgzyogsoce-xinawcovsa-l}}
 +
{{#set: molecular-weight=333.197}}

Revision as of 18:54, 14 January 2021

Metabolite DIHYDRONEOPTERIN-P

  • common-name:
    • 7,8-dihydroneopterin 3'-phosphate
  • smiles:
    • c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
  • inchi-key:
    • plsqmgzyogsoce-xinawcovsa-l
  • molecular-weight:
    • 333.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality