Difference between revisions of "CPD-14407"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Mitogen-Activated-Protein-Kinase-L-Thr == * common-name: ** a [mitogen-activated protein kinase]-l-threonine == Reaction(s) known to cons...") |
(Created page with "Category:metabolite == Metabolite ALPROSTADIL == * common-name: ** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate * smiles: ** cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALPROSTADIL == |
* common-name: | * common-name: | ||
| − | ** | + | ** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate |
| + | * smiles: | ||
| + | ** cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1) | ||
| + | * inchi-key: | ||
| + | ** gmvprgqoioiimi-dwkjamrdsa-m | ||
| + | * molecular-weight: | ||
| + | ** 353.478 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.1.1.197-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.1.1.197-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate}} |
| + | {{#set: inchi-key=inchikey=gmvprgqoioiimi-dwkjamrdsa-m}} | ||
| + | {{#set: molecular-weight=353.478}} | ||
Revision as of 18:54, 14 January 2021
Contents
Metabolite ALPROSTADIL
- common-name:
- (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate
- smiles:
- cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
- inchi-key:
- gmvprgqoioiimi-dwkjamrdsa-m
- molecular-weight:
- 353.478
