Difference between revisions of "CPD-2181"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARDIOLIPIN == * common-name: ** a cardiolipin == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compou...")
(Created page with "Category:metabolite == Metabolite CPD-7535 == * common-name: ** 9,15,9'-tri-cis-ζ-carotene * smiles: ** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARDIOLIPIN ==
+
== Metabolite CPD-7535 ==
 
* common-name:
 
* common-name:
** a cardiolipin
+
** 9,15,9'-tri-cis-ζ-carotene
 +
* smiles:
 +
** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c
 +
* inchi-key:
 +
** biwlelkafxrpde-lmarsqgmsa-n
 +
* molecular-weight:
 +
** 540.914
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11354]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARDIOLIPSYN-RXN]]
+
* [[RXN-11354]]
* [[RXN-8141]]
+
* [[RXN-11355]]
 +
* [[RXN-12244]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cardiolipin}}
+
{{#set: common-name=9,15,9'-tri-cis-ζ-carotene}}
 +
{{#set: inchi-key=inchikey=biwlelkafxrpde-lmarsqgmsa-n}}
 +
{{#set: molecular-weight=540.914}}

Revision as of 18:54, 14 January 2021

Metabolite CPD-7535

  • common-name:
    • 9,15,9'-tri-cis-ζ-carotene
  • smiles:
    • cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c
  • inchi-key:
    • biwlelkafxrpde-lmarsqgmsa-n
  • molecular-weight:
    • 540.914

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality