Difference between revisions of "O-SINAPOYLCHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TAGATOSE-1-6-DIPHOSPHATE == * common-name: ** d-tagatofuranose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=...")
(Created page with "Category:metabolite == Metabolite CPD-13293 == * common-name: ** β-d-fucose * smiles: ** cc1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** shzgcjcmobcmkk-fprjbgldsa-n * molecul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TAGATOSE-1-6-DIPHOSPHATE ==
+
== Metabolite CPD-13293 ==
 
* common-name:
 
* common-name:
** d-tagatofuranose 1,6-bisphosphate
+
** β-d-fucose
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
+
** cc1(c(o)c(o)c(o)c(o)o1)
 
* inchi-key:
 
* inchi-key:
** rnbgygvwrkecfj-oexcpvawsa-j
+
** shzgcjcmobcmkk-fprjbgldsa-n
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 164.158
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TAGAALDOL-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TAGAKIN-RXN]]
+
* [[3.2.1.38-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-tagatofuranose 1,6-bisphosphate}}
+
{{#set: common-name=β-d-fucose}}
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}}
+
{{#set: inchi-key=inchikey=shzgcjcmobcmkk-fprjbgldsa-n}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=164.158}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-13293

  • common-name:
    • β-d-fucose
  • smiles:
    • cc1(c(o)c(o)c(o)c(o)o1)
  • inchi-key:
    • shzgcjcmobcmkk-fprjbgldsa-n
  • molecular-weight:
    • 164.158

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality