Difference between revisions of "CPD-12253"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7630 == * common-name: ** (-)-epicatechin * smiles: ** c3(=c(c2(oc1(=cc(=cc(=c1cc2o)o)o)))c=c(o)c(=c3)o) * inchi-key: ** pftawblqpzve...") |
(Created page with "Category:metabolite == Metabolite N6-L-threonylcarbamoyladenine37-tRNAs == * common-name: ** an n6-l-threonylcarbamoyladenine37 in trna == Reaction(s) known to consume the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N6-L-threonylcarbamoyladenine37-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n6-l-threonylcarbamoyladenine37 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14570]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n6-l-threonylcarbamoyladenine37 in trna}} |
| − | |||
| − | |||
Revision as of 18:55, 14 January 2021
Contents
Metabolite N6-L-threonylcarbamoyladenine37-tRNAs
- common-name:
- an n6-l-threonylcarbamoyladenine37 in trna
