Difference between revisions of "R-1-AMINOPROPAN-2-YL-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15666 == * common-name: ** 2-trans,6-cis-tridecadienoyl-coa * smiles: ** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
(Created page with "Category:metabolite == Metabolite CPD-15838 == * common-name: ** γ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c * inchi-key: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-15666 ==
+
== Metabolite CPD-15838 ==
 
* common-name:
 
* common-name:
−
** 2-trans,6-cis-tridecadienoyl-coa
+
** γ-tocotrienol
 
* smiles:
 
* smiles:
−
** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c
 
* inchi-key:
 
* inchi-key:
−
** oosdlbaxvxkfib-gtubxknvsa-j
+
** otxntmvvoobzcv-wazjvijmsa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 955.803
+
** 410.639
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-14772]]
+
* [[RXN-14918]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14771]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=2-trans,6-cis-tridecadienoyl-coa}}
+
{{#set: common-name=γ-tocotrienol}}
−
{{#set: inchi-key=inchikey=oosdlbaxvxkfib-gtubxknvsa-j}}
+
{{#set: inchi-key=inchikey=otxntmvvoobzcv-wazjvijmsa-n}}
−
{{#set: molecular-weight=955.803}}
+
{{#set: molecular-weight=410.639}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-15838

  • common-name:
    • γ-tocotrienol
  • smiles:
    • cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c
  • inchi-key:
    • otxntmvvoobzcv-wazjvijmsa-n
  • molecular-weight:
    • 410.639

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=R-1-AMINOPROPAN-2-YL-PHOSPHATE&oldid=98744"