Difference between revisions of "HMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GALACTOSE == * common-name: ** β-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-fprjbgldsa-n * m...") |
(Created page with "Category:metabolite == Metabolite Pro-tRNA-2-O-MeCytidine4 == * common-name: ** a 2'-o-methylcytidine4 in trnapro == Reaction(s) known to consume the compound == == Reacti...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Pro-tRNA-2-O-MeCytidine4 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 2'-o-methylcytidine4 in trnapro |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12477]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 2'-o-methylcytidine4 in trnapro}} |
− | |||
− |
Revision as of 18:55, 14 January 2021
Contents
Metabolite Pro-tRNA-2-O-MeCytidine4
- common-name:
- a 2'-o-methylcytidine4 in trnapro