Difference between revisions of "CPD-15687"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE == * common-name: ** n-succinyl-l,l-2,6-diaminopimelate * smiles: ** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])...") |
(Created page with "Category:metabolite == Metabolite CPDMETA-13652 == * common-name: ** raucaffrinoline * smiles: ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6))))) * i...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPDMETA-13652 == |
* common-name: | * common-name: | ||
− | ** | + | ** raucaffrinoline |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6))))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ximpcxfldskalh-vqhwpedhsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 352.432 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12673]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=raucaffrinoline}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ximpcxfldskalh-vqhwpedhsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=352.432}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPDMETA-13652
- common-name:
- raucaffrinoline
- smiles:
- cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6)))))
- inchi-key:
- ximpcxfldskalh-vqhwpedhsa-n
- molecular-weight:
- 352.432