Difference between revisions of "CPD-712"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13398 == * common-name: ** l-alanyl-l-leucine * smiles: ** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o * inchi-key: ** rdikfprvljlmer-bqbzgakwsa...") |
(Created page with "Category:metabolite == Metabolite CPD-15237 == * common-name: ** glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate == Reaction(s) known to consume the compound =...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-15237 == |
* common-name: | * common-name: | ||
− | ** | + | ** glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14361]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate}} |
− | |||
− |
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-15237
- common-name:
- glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate