Difference between revisions of "CPD-9895"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GUANOSINE_DIPHOSPHATE_FUCOSE == * common-name: ** gdp-l-fucose == Reaction(s) known to consume the compound == * RXN-15268 == Reactio...")
(Created page with "Category:metabolite == Metabolite ACETYL-ETCETERA-L-ASPARAGINE == * common-name: ** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GUANOSINE_DIPHOSPHATE_FUCOSE ==
+
== Metabolite ACETYL-ETCETERA-L-ASPARAGINE ==
 
* common-name:
 
* common-name:
** gdp-l-fucose
+
** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine
 +
* smiles:
 +
** cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1)
 +
* inchi-key:
 +
** yttrpbwemmpysw-hrrfrdkfsa-n
 +
* molecular-weight:
 +
** 335.313
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15268]]
+
* [[3.5.1.26-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15268]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-l-fucose}}
+
{{#set: common-name=n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine}}
 +
{{#set: inchi-key=inchikey=yttrpbwemmpysw-hrrfrdkfsa-n}}
 +
{{#set: molecular-weight=335.313}}

Revision as of 18:55, 14 January 2021

Metabolite ACETYL-ETCETERA-L-ASPARAGINE

  • common-name:
    • n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine
  • smiles:
    • cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1)
  • inchi-key:
    • yttrpbwemmpysw-hrrfrdkfsa-n
  • molecular-weight:
    • 335.313

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality