Difference between revisions of "CPD-9895"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GUANOSINE_DIPHOSPHATE_FUCOSE == * common-name: ** gdp-l-fucose == Reaction(s) known to consume the compound == * RXN-15268 == Reactio...") |
(Created page with "Category:metabolite == Metabolite ACETYL-ETCETERA-L-ASPARAGINE == * common-name: ** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ACETYL-ETCETERA-L-ASPARAGINE == |
* common-name: | * common-name: | ||
− | ** | + | ** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine |
+ | * smiles: | ||
+ | ** cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1) | ||
+ | * inchi-key: | ||
+ | ** yttrpbwemmpysw-hrrfrdkfsa-n | ||
+ | * molecular-weight: | ||
+ | ** 335.313 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[3.5.1.26-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine}} |
+ | {{#set: inchi-key=inchikey=yttrpbwemmpysw-hrrfrdkfsa-n}} | ||
+ | {{#set: molecular-weight=335.313}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite ACETYL-ETCETERA-L-ASPARAGINE
- common-name:
- n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine
- smiles:
- cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1)
- inchi-key:
- yttrpbwemmpysw-hrrfrdkfsa-n
- molecular-weight:
- 335.313