Difference between revisions of "N-acetyl-beta-D-hexosamines"

Revision as of 18:55, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-14159 ==
+== Metabolite Ox-Thioredoxin ==
 * common-name:
-** 6''-o-carbamoylkanamycin b
+** an oxidized thioredoxin
-* smiles:
-** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
-* inchi-key:
-** xcstznjiqfivpe-fqsmhnglsa-s
-* molecular-weight:
-** 531.582
 == Reaction(s) known to consume the compound ==
+* [[1.8.4.12-RXN]]
+* [[1.8.4.8-RXN]]
+* [[TDSR]]
+* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-14553]]
+* [[1.17.4.2-RXN]]
-* [[RXN-15287]]
+* [[1.8.4.12-RXN]]
+* [[1.8.4.14-RXN]]
+* [[1.8.4.8-RXN]]
+* [[ADPREDUCT-RXN]]
+* [[CDPREDUCT-RXN]]
+* [[DAOTO]]
+* [[DCDT]]
+* [[DGOTO]]
+* [[DUDT]]
+* [[GDPREDUCT-RXN]]
+* [[MERCAPYSTRANS-RXN]]
+* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
+* [[RXN-12019]]
+* [[RXN-8668]]
+* [[RXN0-267]]
+* [[RXN0-5468]]
+* [[UDPREDUCT-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=6''-o-carbamoylkanamycin b}}
+{{#set: common-name=an oxidized thioredoxin}}
-{{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}}
-{{#set: molecular-weight=531.582}}