Difference between revisions of "CPD-15370"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SN-GLYCEROL-1-PHOSPHATE == * common-name: ** sn-glycerol 1-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviaj...") |
(Created page with "Category:metabolite == Metabolite O-phospho-L-seryl-tRNASecs == * common-name: ** an o-phospho-l-seryl-[trnasec] == Reaction(s) known to consume the compound == * RXN-10...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite O-phospho-L-seryl-tRNASecs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an o-phospho-l-seryl-[trnasec] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10038]] |
| − | * [[RXN- | + | * [[RXN-10039]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10038]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an o-phospho-l-seryl-[trnasec]}} |
| − | |||
| − | |||
Revision as of 18:55, 14 January 2021
Contents
Metabolite O-phospho-L-seryl-tRNASecs
- common-name:
- an o-phospho-l-seryl-[trnasec]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an o-phospho-l-seryl-[trnasec" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
