Difference between revisions of "CPD-292"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 18-HYDROXYOLEATE == * common-name: ** 18-hydroxyoleate * smiles: ** c(o)cccccccc=ccccccccc(=o)[o-] * inchi-key: ** lquhzvlttwmbto-uphrsur...") |
(Created page with "Category:metabolite == Metabolite diacyl-3-O-glucl-1-6-gluc-sn-glycerol == * common-name: ** a 1,2-diacyl-3-o-(β-d-glucopyranosyl-(1->6)-o-β-d-glucopyranosyl)-sn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite diacyl-3-O-glucl-1-6-gluc-sn-glycerol == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 1,2-diacyl-3-o-(β-d-glucopyranosyl-(1->6)-o-β-d-glucopyranosyl)-sn-glycerol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15117]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 1,2-diacyl-3-o-(β-d-glucopyranosyl-(1->6)-o-β-d-glucopyranosyl)-sn-glycerol}} |
| − | |||
| − | |||
Revision as of 18:55, 14 January 2021
Contents
Metabolite diacyl-3-O-glucl-1-6-gluc-sn-glycerol
- common-name:
- a 1,2-diacyl-3-o-(β-d-glucopyranosyl-(1->6)-o-β-d-glucopyranosyl)-sn-glycerol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 1,2-diacyl-3-o-(β-d-glucopyranosyl-(1->6)-o-β-d-glucopyranosyl)-sn-glycerol" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
