Difference between revisions of "CHONDROITIN-46-DISULFATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-Acyl-sn-glycerol-3-phosphates == * common-name: ** a 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * [...")
(Created page with "Category:metabolite == Metabolite CPD-15839 == * common-name: ** δ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c * inchi-key: ** o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-Acyl-sn-glycerol-3-phosphates ==
+
== Metabolite CPD-15839 ==
 
* common-name:
 
* common-name:
** a 2-acyl-sn-glycerol 3-phosphate
+
** δ-tocotrienol
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c
 +
* inchi-key:
 +
** odadklylwwchnb-ldybvbfysa-n
 +
* molecular-weight:
 +
** 396.612
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13112]]
+
* [[RXN-14919]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13112]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2-acyl-sn-glycerol 3-phosphate}}
+
{{#set: common-name=δ-tocotrienol}}
 +
{{#set: inchi-key=inchikey=odadklylwwchnb-ldybvbfysa-n}}
 +
{{#set: molecular-weight=396.612}}

Revision as of 18:56, 14 January 2021

Metabolite CPD-15839

  • common-name:
    • δ-tocotrienol
  • smiles:
    • cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c
  • inchi-key:
    • odadklylwwchnb-ldybvbfysa-n
  • molecular-weight:
    • 396.612

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality