Difference between revisions of "Pre-tRNA-5-prime-half-molecules"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n *...")
(Created page with "Category:metabolite == Metabolite CPD1F-135 == * common-name: ** trans-neoxanthin * smiles: ** cc(c=cc=c(c)[ch]=c=c1(c(o)(c)cc(o)cc(c)(c)1))=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite URIDINE ==
+
== Metabolite CPD1F-135 ==
 
* common-name:
 
* common-name:
** uridine
+
** trans-neoxanthin
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
+
** cc(c=cc=c(c)[ch]=c=c1(c(o)(c)cc(o)cc(c)(c)1))=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3)
 
* inchi-key:
 
* inchi-key:
** drtqhjpvmgbucf-xvfcmesisa-n
+
** pgyaysrvsajxte-clonmanbsa-n
 
* molecular-weight:
 
* molecular-weight:
** 244.204
+
** 600.88
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AUPT]]
+
* [[RXN-8074]]
* [[DATUP]]
 
* [[DCTUP]]
 
* [[DGTUP]]
 
* [[DTTUP]]
 
* [[DUTUP]]
 
* [[GTUP]]
 
* [[ITUP]]
 
* [[URIDINE-NUCLEOSIDASE-RXN]]
 
* [[URIDINEKIN-RXN]]
 
* [[URKI-RXN]]
 
* [[URPHOS-RXN]]
 
* [[UTUP]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYTIDEAM2-RXN]]
+
* [[RXN1F-155]]
* [[RXN-14025]]
 
* [[UMPP]]
 
* [[URPHOS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uridine}}
+
{{#set: common-name=trans-neoxanthin}}
{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
+
{{#set: inchi-key=inchikey=pgyaysrvsajxte-clonmanbsa-n}}
{{#set: molecular-weight=244.204}}
+
{{#set: molecular-weight=600.88}}

Revision as of 18:56, 14 January 2021

Metabolite CPD1F-135

  • common-name:
    • trans-neoxanthin
  • smiles:
    • cc(c=cc=c(c)[ch]=c=c1(c(o)(c)cc(o)cc(c)(c)1))=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3)
  • inchi-key:
    • pgyaysrvsajxte-clonmanbsa-n
  • molecular-weight:
    • 600.88

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality