Difference between revisions of "5-OXOPROLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE == * common-name: ** gdp-4-dehydro-α-d-rhamnose * smiles: ** cc4(oc(op(=o)([o-])op(=o)([o-])occ1(oc...") |
(Created page with "Category:metabolite == Metabolite DOPAMINE == * common-name: ** dopamine * smiles: ** c(cc1(c=c(c(=cc=1)o)o))[n+] * inchi-key: ** vyfyytllbukuhu-uhfffaoysa-o * molecular-w...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DOPAMINE == |
* common-name: | * common-name: | ||
− | ** | + | ** dopamine |
* smiles: | * smiles: | ||
− | ** | + | ** c(cc1(c=c(c(=cc=1)o)o))[n+] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vyfyytllbukuhu-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 154.188 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] |
+ | * [[RXN6666-4]] | ||
+ | * [[RXN6666-9]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-221]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dopamine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vyfyytllbukuhu-uhfffaoysa-o}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=154.188}} |
Revision as of 18:56, 14 January 2021
Contents
Metabolite DOPAMINE
- common-name:
- dopamine
- smiles:
- c(cc1(c=c(c(=cc=1)o)o))[n+]
- inchi-key:
- vyfyytllbukuhu-uhfffaoysa-o
- molecular-weight:
- 154.188