Difference between revisions of "CPD-9973"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AICAR == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc...")
(Created page with "Category:metabolite == Metabolite Primary-Amines == * common-name: ** a primary amine == Reaction(s) known to consume the compound == * ARYLAMINE-SULFOTRANSFERASE-RXN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite AICAR ==
+
== Metabolite Primary-Amines ==
 
* common-name:
 
* common-name:
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
+
** a primary amine
* smiles:
 
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
 
* inchi-key:
 
** notgfiuvdgnkri-uuokfmhzsa-l
 
* molecular-weight:
 
** 336.197
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AIAL]]
+
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
* [[AICARSYN-RXN]]
 
* [[AICARTRANSFORM-RXN]]
 
* [[FPAIF]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AIAL]]
+
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
* [[AICARSYN-RXN]]
+
* [[RXN-9598]]
* [[AICARTRANSFORM-RXN]]
 
* [[FPAIF]]
 
* [[GLUTAMIDOTRANS-RXN]]
 
* [[RXN-14270]]
 
* [[RXN-17900]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide}}
+
{{#set: common-name=a primary amine}}
{{#set: inchi-key=inchikey=notgfiuvdgnkri-uuokfmhzsa-l}}
 
{{#set: molecular-weight=336.197}}
 

Revision as of 18:56, 14 January 2021

Metabolite Primary-Amines

  • common-name:
    • a primary amine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality