Difference between revisions of "50S-Ribosomal-subunit-protein-L16-Arg"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-DOCOSAPENTAENOYL-ACP == * common-name: ** a (3r)-3-hydroxy-docosapentaenoyl-[acp] == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite 3-SULFINOALANINE == * common-name: ** 3-sulfinoalanine * smiles: ** c(c([n+])c(=o)[o-])s([o-])=o * inchi-key: ** advptqaunprnpo-reohclbhs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXY-DOCOSAPENTAENOYL-ACP ==
+
== Metabolite 3-SULFINOALANINE ==
 
* common-name:
 
* common-name:
** a (3r)-3-hydroxy-docosapentaenoyl-[acp]
+
** 3-sulfinoalanine
 +
* smiles:
 +
** c(c([n+])c(=o)[o-])s([o-])=o
 +
* inchi-key:
 +
** advptqaunprnpo-reohclbhsa-m
 +
* molecular-weight:
 +
** 152.145
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13008]]
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[CYSTEINE-DIOXYGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (3r)-3-hydroxy-docosapentaenoyl-[acp]}}
+
{{#set: common-name=3-sulfinoalanine}}
 +
{{#set: inchi-key=inchikey=advptqaunprnpo-reohclbhsa-m}}
 +
{{#set: molecular-weight=152.145}}

Revision as of 18:56, 14 January 2021

Metabolite 3-SULFINOALANINE

  • common-name:
    • 3-sulfinoalanine
  • smiles:
    • c(c([n+])c(=o)[o-])s([o-])=o
  • inchi-key:
    • advptqaunprnpo-reohclbhsa-m
  • molecular-weight:
    • 152.145

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality