Difference between revisions of "50S-Ribosomal-subunit-protein-L16-Arg"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-DOCOSAPENTAENOYL-ACP == * common-name: ** a (3r)-3-hydroxy-docosapentaenoyl-[acp] == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite 3-SULFINOALANINE == * common-name: ** 3-sulfinoalanine * smiles: ** c(c([n+])c(=o)[o-])s([o-])=o * inchi-key: ** advptqaunprnpo-reohclbhs...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite 3- | + | == Metabolite 3-SULFINOALANINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-sulfinoalanine |
+ | * smiles: | ||
+ | ** c(c([n+])c(=o)[o-])s([o-])=o | ||
+ | * inchi-key: | ||
+ | ** advptqaunprnpo-reohclbhsa-m | ||
+ | * molecular-weight: | ||
+ | ** 152.145 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] |
+ | * [[CYSTEINE-DIOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-sulfinoalanine}} |
+ | {{#set: inchi-key=inchikey=advptqaunprnpo-reohclbhsa-m}} | ||
+ | {{#set: molecular-weight=152.145}} |
Revision as of 18:56, 14 January 2021
Contents
Metabolite 3-SULFINOALANINE
- common-name:
- 3-sulfinoalanine
- smiles:
- c(c([n+])c(=o)[o-])s([o-])=o
- inchi-key:
- advptqaunprnpo-reohclbhsa-m
- molecular-weight:
- 152.145