Difference between revisions of "Holo-EntB"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1027 == * common-name: ** a debranched α-limit dextrin == Reaction(s) known to consume the compound == * RXN-9025 == React...")
(Created page with "Category:metabolite == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == * common-name: ** luteolin 7-o-β-d-diglucuronide * smiles: ** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1027 ==
+
== Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE ==
 
* common-name:
 
* common-name:
** a debranched α-limit dextrin
+
** luteolin 7-o-β-d-diglucuronide
 +
* smiles:
 +
** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
 +
* inchi-key:
 +
** pbbvwjqpazyqdb-dbfweqbmsa-l
 +
* molecular-weight:
 +
** 636.476
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9025]]
+
* [[RXN-15288]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a debranched α-limit dextrin}}
+
{{#set: common-name=luteolin 7-o-β-d-diglucuronide}}
 +
{{#set: inchi-key=inchikey=pbbvwjqpazyqdb-dbfweqbmsa-l}}
 +
{{#set: molecular-weight=636.476}}

Revision as of 18:57, 14 January 2021

Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE

  • common-name:
    • luteolin 7-o-β-d-diglucuronide
  • smiles:
    • c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
  • inchi-key:
    • pbbvwjqpazyqdb-dbfweqbmsa-l
  • molecular-weight:
    • 636.476

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality