Difference between revisions of "BR-"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UROCANATE == * common-name: ** urocanate * smiles: ** c1(nc=nc=1c=cc([o-])=o) * inchi-key: ** loiymiarkyctbw-owojbtedsa-m * molecular-wei...")
(Created page with "Category:metabolite == Metabolite CPD-12127 == * common-name: ** menaquinol-10 * smiles: ** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UROCANATE ==
+
== Metabolite CPD-12127 ==
 
* common-name:
 
* common-name:
** urocanate
+
** menaquinol-10
 
* smiles:
 
* smiles:
** c1(nc=nc=1c=cc([o-])=o)
+
** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
 
* inchi-key:
 
* inchi-key:
** loiymiarkyctbw-owojbtedsa-m
+
** wlkiromwgyxjma-uqunhumxsa-n
 
* molecular-weight:
 
* molecular-weight:
** 137.118
+
** 855.381
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTIDINE-AMMONIA-LYASE-RXN]]
+
* [[RXN-9361]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=urocanate}}
+
{{#set: common-name=menaquinol-10}}
{{#set: inchi-key=inchikey=loiymiarkyctbw-owojbtedsa-m}}
+
{{#set: inchi-key=inchikey=wlkiromwgyxjma-uqunhumxsa-n}}
{{#set: molecular-weight=137.118}}
+
{{#set: molecular-weight=855.381}}

Revision as of 18:57, 14 January 2021

Metabolite CPD-12127

  • common-name:
    • menaquinol-10
  • smiles:
    • cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
  • inchi-key:
    • wlkiromwgyxjma-uqunhumxsa-n
  • molecular-weight:
    • 855.381

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality