Difference between revisions of "L-ORNITHINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROHYDROXYPHOSPHORYLPYRUVATE == * common-name: ** 3-(hydroxyphosphinoyl)pyruvate * smiles: ** c([o-])(=o)c(=o)c[ph]([o-])=o * inchi-k...") |
(Created page with "Category:metabolite == Metabolite CPD-12120 == * common-name: ** demethylmenaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12120 == |
* common-name: | * common-name: | ||
| − | ** | + | ** demethylmenaquinol-11 |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wvrzwraihitkpi-sokmhqjssa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 909.472 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9362]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=demethylmenaquinol-11}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wvrzwraihitkpi-sokmhqjssa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=909.472}} |
Revision as of 18:57, 14 January 2021
Contents
Metabolite CPD-12120
- common-name:
- demethylmenaquinol-11
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
- inchi-key:
- wvrzwraihitkpi-sokmhqjssa-n
- molecular-weight:
- 909.472
