Difference between revisions of "Cleaved-type-1-transmembrane-domains"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MESO-DIAMINOPIMELATE == * common-name: ** meso-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezv...")
(Created page with "Category:metabolite == Metabolite 3-OXO-EICOSAPENTAENOYL-ACP == * common-name: ** a 3-oxo-docosapentaenoyl [acp] == Reaction(s) known to consume the compound == * RXN-13...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MESO-DIAMINOPIMELATE ==
+
== Metabolite 3-OXO-EICOSAPENTAENOYL-ACP ==
 
* common-name:
 
* common-name:
** meso-diaminopimelate
+
** a 3-oxo-docosapentaenoyl [acp]
* smiles:
 
** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
 
* inchi-key:
 
** gmkmezvlhjarhf-sydprgilsa-n
 
* molecular-weight:
 
** 190.199
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIAMINOPIMDECARB-RXN]]
+
* [[RXN-13008]]
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 
* [[DIAMINOPIMEPIM-RXN]]
 
* [[RXN-14246]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 
* [[DIAMINOPIMEPIM-RXN]]
 
* [[RXN-14246]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=meso-diaminopimelate}}
+
{{#set: common-name=a 3-oxo-docosapentaenoyl [acp]}}
{{#set: inchi-key=inchikey=gmkmezvlhjarhf-sydprgilsa-n}}
 
{{#set: molecular-weight=190.199}}
 

Revision as of 18:57, 14 January 2021

Metabolite 3-OXO-EICOSAPENTAENOYL-ACP

  • common-name:
    • a 3-oxo-docosapentaenoyl [acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-docosapentaenoyl [acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.